C30H30F3N5S — CID 100528760
(4R,5R)-1-(3-anilinopropyl)-5-[2,5-dimethyl-1-[3-(trifluoromethyl)phenyl]pyrrol-3-yl]-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 100528760) has the molecular formula C30H30F3N5S and a molecular weight of 549.67 g/mol. Its IUPAC name is (4R,5R)-1-(3-anilinopropyl)-5-[2,5-dimethyl-1-[3-(trifluoromethyl)phenyl]pyrrol-3-yl]-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | (4R,5R)-1-(3-anilinopropyl)-5-[2,5-dimethyl-1-[3-(trifluoromethyl)phenyl]pyrrol-3-yl]-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 100528760 |
| Molecular Formula | C30H30F3N5S |
| Molecular Weight | 549.67 g/mol |
| Exact Mass | 549.22 |
| IUPAC Name | (4R,5R)-1-(3-anilinopropyl)-5-[2,5-dimethyl-1-[3-(trifluoromethyl)phenyl]pyrrol-3-yl]-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | Cc1cc([C@@H]2[C@H](c3ccccn3)NC(=S)N2CCCNc2ccccc2)c(C)n1-c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C30H30F3N5S/c1-20-18-25(21(2)38(20)24-13-8-10-22(19-24)30(31,32)33)28-27(26-14-6-7-15-35-26)36-29(39)37(28)17-9-16-34-23-11-4-3-5-12-23/h3-8,10-15,18-19,27-28,34H,9,16-17H2,1-2H3,(H,36,39)/t27-,28+/m0/s1 |
| InChIKey | XREPKZKFXUQCEW-WUFINQPMSA-N |
| XLogP | 6.98 |
| TPSA | 45.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.67 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|