C30H27F4N5OS — CID 133208917
3-[5-[2,5-dimethyl-1-[3-(trifluoromethyl)phenyl]pyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-N-(2-fluorophenyl)propanamide (PubChem CID 133208917) has the molecular formula C30H27F4N5OS and a molecular weight of 581.64 g/mol. Its IUPAC name is 3-[5-[2,5-dimethyl-1-[3-(trifluoromethyl)phenyl]pyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-N-(2-fluorophenyl)propanamide.
| Compound Name | 3-[5-[2,5-dimethyl-1-[3-(trifluoromethyl)phenyl]pyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-N-(2-fluorophenyl)propanamide |
|---|---|
| PubChem CID | 133208917 |
| Molecular Formula | C30H27F4N5OS |
| Molecular Weight | 581.64 g/mol |
| Exact Mass | 581.19 |
| IUPAC Name | 3-[5-[2,5-dimethyl-1-[3-(trifluoromethyl)phenyl]pyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-N-(2-fluorophenyl)propanamide |
| SMILES | Cc1cc(C2C(c3ccccn3)NC(=S)N2CCC(=O)Nc2ccccc2F)c(C)n1-c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C30H27F4N5OS/c1-18-16-22(19(2)39(18)21-9-7-8-20(17-21)30(32,33)34)28-27(25-12-5-6-14-35-25)37-29(41)38(28)15-13-26(40)36-24-11-4-3-10-23(24)31/h3-12,14,16-17,27-28H,13,15H2,1-2H3,(H,36,40)(H,37,41) |
| InChIKey | AOGKYWAHSQBDBP-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 62.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.64 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|