C29H26F3N5OS — CID 133208277
2-[5-[2,5-dimethyl-1-[3-(trifluoromethyl)phenyl]pyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-N-phenylacetamide (PubChem CID 133208277) has the molecular formula C29H26F3N5OS and a molecular weight of 549.62 g/mol. Its IUPAC name is 2-[5-[2,5-dimethyl-1-[3-(trifluoromethyl)phenyl]pyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-N-phenylacetamide.
| Compound Name | 2-[5-[2,5-dimethyl-1-[3-(trifluoromethyl)phenyl]pyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-N-phenylacetamide |
|---|---|
| PubChem CID | 133208277 |
| Molecular Formula | C29H26F3N5OS |
| Molecular Weight | 549.62 g/mol |
| Exact Mass | 549.18 |
| IUPAC Name | 2-[5-[2,5-dimethyl-1-[3-(trifluoromethyl)phenyl]pyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-N-phenylacetamide |
| SMILES | Cc1cc(C2C(c3ccccn3)NC(=S)N2CC(=O)Nc2ccccc2)c(C)n1-c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C29H26F3N5OS/c1-18-15-23(19(2)37(18)22-12-8-9-20(16-22)29(30,31)32)27-26(24-13-6-7-14-33-24)35-28(39)36(27)17-25(38)34-21-10-4-3-5-11-21/h3-16,26-27H,17H2,1-2H3,(H,34,38)(H,35,39) |
| InChIKey | DZZHDYOBOJIJPT-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 62.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.62 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|