C28H26FN5OS — CID 100658581
2-[(4R,5R)-5-[1-(4-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-N-phenylacetamide (PubChem CID 100658581) has the molecular formula C28H26FN5OS and a molecular weight of 499.62 g/mol. Its IUPAC name is 2-[(4R,5R)-5-[1-(4-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-N-phenylacetamide.
| Compound Name | 2-[(4R,5R)-5-[1-(4-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-N-phenylacetamide |
|---|---|
| PubChem CID | 100658581 |
| Molecular Formula | C28H26FN5OS |
| Molecular Weight | 499.62 g/mol |
| Exact Mass | 499.18 |
| IUPAC Name | 2-[(4R,5R)-5-[1-(4-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-N-phenylacetamide |
| SMILES | Cc1cc([C@@H]2[C@H](c3ccccn3)NC(=S)N2CC(=O)Nc2ccccc2)c(C)n1-c1ccc(F)cc1 |
| InChI | InChI=1S/C28H26FN5OS/c1-18-16-23(19(2)34(18)22-13-11-20(29)12-14-22)27-26(24-10-6-7-15-30-24)32-28(36)33(27)17-25(35)31-21-8-4-3-5-9-21/h3-16,26-27H,17H2,1-2H3,(H,31,35)(H,32,36)/t26-,27+/m0/s1 |
| InChIKey | WUEUHPFVRMTZTD-RRPNLBNLSA-N |
| XLogP | 5.24 |
| TPSA | 62.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.62 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|