C26H27F3N4OS — CID 133223538
5-[2,5-dimethyl-1-[3-(trifluoromethyl)phenyl]pyrrol-3-yl]-1-(oxolan-2-ylmethyl)-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 133223538) has the molecular formula C26H27F3N4OS and a molecular weight of 500.59 g/mol. Its IUPAC name is 5-[2,5-dimethyl-1-[3-(trifluoromethyl)phenyl]pyrrol-3-yl]-1-(oxolan-2-ylmethyl)-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | 5-[2,5-dimethyl-1-[3-(trifluoromethyl)phenyl]pyrrol-3-yl]-1-(oxolan-2-ylmethyl)-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 133223538 |
| Molecular Formula | C26H27F3N4OS |
| Molecular Weight | 500.59 g/mol |
| Exact Mass | 500.19 |
| IUPAC Name | 5-[2,5-dimethyl-1-[3-(trifluoromethyl)phenyl]pyrrol-3-yl]-1-(oxolan-2-ylmethyl)-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | Cc1cc(C2C(c3ccccn3)NC(=S)N2CC2CCCO2)c(C)n1-c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C26H27F3N4OS/c1-16-13-21(17(2)33(16)19-8-5-7-18(14-19)26(27,28)29)24-23(22-10-3-4-11-30-22)31-25(35)32(24)15-20-9-6-12-34-20/h3-5,7-8,10-11,13-14,20,23-24H,6,9,12,15H2,1-2H3,(H,31,35) |
| InChIKey | GJYCMRTZEGGRDN-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 42.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.59 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|