C26H29ClN4O2S — CID 133223618
5-[1-(5-chloro-2-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]-1-(oxolan-2-ylmethyl)-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 133223618) has the molecular formula C26H29ClN4O2S and a molecular weight of 497.06 g/mol. Its IUPAC name is 5-[1-(5-chloro-2-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]-1-(oxolan-2-ylmethyl)-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | 5-[1-(5-chloro-2-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]-1-(oxolan-2-ylmethyl)-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 133223618 |
| Molecular Formula | C26H29ClN4O2S |
| Molecular Weight | 497.06 g/mol |
| Exact Mass | 496.17 |
| IUPAC Name | 5-[1-(5-chloro-2-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]-1-(oxolan-2-ylmethyl)-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | COc1ccc(Cl)cc1-n1c(C)cc(C2C(c3ccccn3)NC(=S)N2CC2CCCO2)c1C |
| InChI | InChI=1S/C26H29ClN4O2S/c1-16-13-20(17(2)31(16)22-14-18(27)9-10-23(22)32-3)25-24(21-8-4-5-11-28-21)29-26(34)30(25)15-19-7-6-12-33-19/h4-5,8-11,13-14,19,24-25H,6-7,12,15H2,1-3H3,(H,29,34) |
| InChIKey | VLBIDAVOCPLATJ-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 51.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.06 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|