C28H27ClN4OS — CID 133157886
5-[1-(5-chloro-2-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]-1-(4-methylphenyl)-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 133157886) has the molecular formula C28H27ClN4OS and a molecular weight of 503.07 g/mol. Its IUPAC name is 5-[1-(5-chloro-2-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]-1-(4-methylphenyl)-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | 5-[1-(5-chloro-2-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]-1-(4-methylphenyl)-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 133157886 |
| Molecular Formula | C28H27ClN4OS |
| Molecular Weight | 503.07 g/mol |
| Exact Mass | 502.16 |
| IUPAC Name | 5-[1-(5-chloro-2-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]-1-(4-methylphenyl)-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | COc1ccc(Cl)cc1-n1c(C)cc(C2C(c3ccccn3)NC(=S)N2c2ccc(C)cc2)c1C |
| InChI | InChI=1S/C28H27ClN4OS/c1-17-8-11-21(12-9-17)33-27(26(31-28(33)35)23-7-5-6-14-30-23)22-15-18(2)32(19(22)3)24-16-20(29)10-13-25(24)34-4/h5-16,26-27H,1-4H3,(H,31,35) |
| InChIKey | KMXKONDUGOSPRF-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 42.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.07 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|