C27H24ClFN4OS — CID 133224491
1-(3-chloro-4-methoxyphenyl)-5-[1-(2-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 133224491) has the molecular formula C27H24ClFN4OS and a molecular weight of 507.03 g/mol. Its IUPAC name is 1-(3-chloro-4-methoxyphenyl)-5-[1-(2-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | 1-(3-chloro-4-methoxyphenyl)-5-[1-(2-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 133224491 |
| Molecular Formula | C27H24ClFN4OS |
| Molecular Weight | 507.03 g/mol |
| Exact Mass | 506.13 |
| IUPAC Name | 1-(3-chloro-4-methoxyphenyl)-5-[1-(2-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | COc1ccc(N2C(=S)NC(c3ccccn3)C2c2cc(C)n(-c3ccccc3F)c2C)cc1Cl |
| InChI | InChI=1S/C27H24ClFN4OS/c1-16-14-19(17(2)32(16)23-10-5-4-8-21(23)29)26-25(22-9-6-7-13-30-22)31-27(35)33(26)18-11-12-24(34-3)20(28)15-18/h4-15,25-26H,1-3H3,(H,31,35) |
| InChIKey | MOHJIAIJMIONCZ-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 42.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.03 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|