C27H24Cl2N4O2S — CID 133224464
5-[1-(5-chloro-2-hydroxyphenyl)-2,5-dimethylpyrrol-3-yl]-1-(3-chloro-4-methoxyphenyl)-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 133224464) has the molecular formula C27H24Cl2N4O2S and a molecular weight of 539.49 g/mol. Its IUPAC name is 5-[1-(5-chloro-2-hydroxyphenyl)-2,5-dimethylpyrrol-3-yl]-1-(3-chloro-4-methoxyphenyl)-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | 5-[1-(5-chloro-2-hydroxyphenyl)-2,5-dimethylpyrrol-3-yl]-1-(3-chloro-4-methoxyphenyl)-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 133224464 |
| Molecular Formula | C27H24Cl2N4O2S |
| Molecular Weight | 539.49 g/mol |
| Exact Mass | 538.10 |
| IUPAC Name | 5-[1-(5-chloro-2-hydroxyphenyl)-2,5-dimethylpyrrol-3-yl]-1-(3-chloro-4-methoxyphenyl)-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | COc1ccc(N2C(=S)NC(c3ccccn3)C2c2cc(C)n(-c3cc(Cl)ccc3O)c2C)cc1Cl |
| InChI | InChI=1S/C27H24Cl2N4O2S/c1-15-12-19(16(2)32(15)22-13-17(28)7-9-23(22)34)26-25(21-6-4-5-11-30-21)31-27(36)33(26)18-8-10-24(35-3)20(29)14-18/h4-14,25-26,34H,1-3H3,(H,31,36) |
| InChIKey | LZUZGKXYIPVSGS-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.49 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|