C27H24BrClN4OS — CID 100505520
(4S,5S)-1-(4-bromo-3-methylphenyl)-5-[1-(5-chloro-2-hydroxyphenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 100505520) has the molecular formula C27H24BrClN4OS and a molecular weight of 567.94 g/mol. Its IUPAC name is (4S,5S)-1-(4-bromo-3-methylphenyl)-5-[1-(5-chloro-2-hydroxyphenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | (4S,5S)-1-(4-bromo-3-methylphenyl)-5-[1-(5-chloro-2-hydroxyphenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 100505520 |
| Molecular Formula | C27H24BrClN4OS |
| Molecular Weight | 567.94 g/mol |
| Exact Mass | 566.05 |
| IUPAC Name | (4S,5S)-1-(4-bromo-3-methylphenyl)-5-[1-(5-chloro-2-hydroxyphenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | Cc1cc(N2C(=S)N[C@H](c3ccccn3)[C@@H]2c2cc(C)n(-c3cc(Cl)ccc3O)c2C)ccc1Br |
| InChI | InChI=1S/C27H24BrClN4OS/c1-15-12-19(8-9-21(15)28)33-26(25(31-27(33)35)22-6-4-5-11-30-22)20-13-16(2)32(17(20)3)23-14-18(29)7-10-24(23)34/h4-14,25-26,34H,1-3H3,(H,31,35)/t25-,26+/m1/s1 |
| InChIKey | DLRUODWNIUDGBX-FTJBHMTQSA-N |
| XLogP | 7.10 |
| TPSA | 53.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.94 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|