C27H24BrClN4S — CID 100506574
(4S,5S)-1-(4-bromo-3-methylphenyl)-5-[1-(2-chlorophenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 100506574) has the molecular formula C27H24BrClN4S and a molecular weight of 551.94 g/mol. Its IUPAC name is (4S,5S)-1-(4-bromo-3-methylphenyl)-5-[1-(2-chlorophenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | (4S,5S)-1-(4-bromo-3-methylphenyl)-5-[1-(2-chlorophenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 100506574 |
| Molecular Formula | C27H24BrClN4S |
| Molecular Weight | 551.94 g/mol |
| Exact Mass | 550.06 |
| IUPAC Name | (4S,5S)-1-(4-bromo-3-methylphenyl)-5-[1-(2-chlorophenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | Cc1cc(N2C(=S)N[C@H](c3ccccn3)[C@@H]2c2cc(C)n(-c3ccccc3Cl)c2C)ccc1Br |
| InChI | InChI=1S/C27H24BrClN4S/c1-16-14-19(11-12-21(16)28)33-26(25(31-27(33)34)23-9-6-7-13-30-23)20-15-17(2)32(18(20)3)24-10-5-4-8-22(24)29/h4-15,25-26H,1-3H3,(H,31,34)/t25-,26+/m1/s1 |
| InChIKey | QJBJVJFFRZAXGT-FTJBHMTQSA-N |
| XLogP | 7.39 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.94 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|