C29H29BrN4S — CID 100507223
(4R,5S)-1-(4-bromo-3-methylphenyl)-5-[1-(2,5-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 100507223) has the molecular formula C29H29BrN4S and a molecular weight of 545.55 g/mol. Its IUPAC name is (4R,5S)-1-(4-bromo-3-methylphenyl)-5-[1-(2,5-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | (4R,5S)-1-(4-bromo-3-methylphenyl)-5-[1-(2,5-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 100507223 |
| Molecular Formula | C29H29BrN4S |
| Molecular Weight | 545.55 g/mol |
| Exact Mass | 544.13 |
| IUPAC Name | (4R,5S)-1-(4-bromo-3-methylphenyl)-5-[1-(2,5-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | Cc1ccc(C)c(-n2c(C)cc([C@H]3[C@H](c4ccccn4)NC(=S)N3c3ccc(Br)c(C)c3)c2C)c1 |
| InChI | InChI=1S/C29H29BrN4S/c1-17-9-10-18(2)26(14-17)33-20(4)16-23(21(33)5)28-27(25-8-6-7-13-31-25)32-29(35)34(28)22-11-12-24(30)19(3)15-22/h6-16,27-28H,1-5H3,(H,32,35)/t27-,28-/m0/s1 |
| InChIKey | XRRVMMGUJKTHDY-NSOVKSMOSA-N |
| XLogP | 7.35 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.55 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|