C27H25BrN4OS — CID 133224328
1-(4-bromo-3-methylphenyl)-5-[1-(4-hydroxyphenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 133224328) has the molecular formula C27H25BrN4OS and a molecular weight of 533.50 g/mol. Its IUPAC name is 1-(4-bromo-3-methylphenyl)-5-[1-(4-hydroxyphenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | 1-(4-bromo-3-methylphenyl)-5-[1-(4-hydroxyphenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 133224328 |
| Molecular Formula | C27H25BrN4OS |
| Molecular Weight | 533.50 g/mol |
| Exact Mass | 532.09 |
| IUPAC Name | 1-(4-bromo-3-methylphenyl)-5-[1-(4-hydroxyphenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | Cc1cc(N2C(=S)NC(c3ccccn3)C2c2cc(C)n(-c3ccc(O)cc3)c2C)ccc1Br |
| InChI | InChI=1S/C27H25BrN4OS/c1-16-14-20(9-12-23(16)28)32-26(25(30-27(32)34)24-6-4-5-13-29-24)22-15-17(2)31(18(22)3)19-7-10-21(33)11-8-19/h4-15,25-26,33H,1-3H3,(H,30,34) |
| InChIKey | FUZXLWBVBPOKAZ-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 53.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.50 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|