C28H27BrN4S — CID 100506319
(4S,5S)-1-(4-bromo-3-methylphenyl)-5-[2,5-dimethyl-1-(4-methylphenyl)pyrrol-3-yl]-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 100506319) has the molecular formula C28H27BrN4S and a molecular weight of 531.52 g/mol. Its IUPAC name is (4S,5S)-1-(4-bromo-3-methylphenyl)-5-[2,5-dimethyl-1-(4-methylphenyl)pyrrol-3-yl]-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | (4S,5S)-1-(4-bromo-3-methylphenyl)-5-[2,5-dimethyl-1-(4-methylphenyl)pyrrol-3-yl]-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 100506319 |
| Molecular Formula | C28H27BrN4S |
| Molecular Weight | 531.52 g/mol |
| Exact Mass | 530.11 |
| IUPAC Name | (4S,5S)-1-(4-bromo-3-methylphenyl)-5-[2,5-dimethyl-1-(4-methylphenyl)pyrrol-3-yl]-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | Cc1ccc(-n2c(C)cc([C@H]3[C@@H](c4ccccn4)NC(=S)N3c3ccc(Br)c(C)c3)c2C)cc1 |
| InChI | InChI=1S/C28H27BrN4S/c1-17-8-10-21(11-9-17)32-19(3)16-23(20(32)4)27-26(25-7-5-6-14-30-25)31-28(34)33(27)22-12-13-24(29)18(2)15-22/h5-16,26-27H,1-4H3,(H,31,34)/t26-,27+/m1/s1 |
| InChIKey | BXGZSAIBWQCORP-SXOMAYOGSA-N |
| XLogP | 7.05 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.52 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|