C27H25ClN4OS — CID 133155998
5-[1-(2-chlorophenyl)-2,5-dimethylpyrrol-3-yl]-1-(4-methoxyphenyl)-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 133155998) has the molecular formula C27H25ClN4OS and a molecular weight of 489.04 g/mol. Its IUPAC name is 5-[1-(2-chlorophenyl)-2,5-dimethylpyrrol-3-yl]-1-(4-methoxyphenyl)-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | 5-[1-(2-chlorophenyl)-2,5-dimethylpyrrol-3-yl]-1-(4-methoxyphenyl)-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 133155998 |
| Molecular Formula | C27H25ClN4OS |
| Molecular Weight | 489.04 g/mol |
| Exact Mass | 488.14 |
| IUPAC Name | 5-[1-(2-chlorophenyl)-2,5-dimethylpyrrol-3-yl]-1-(4-methoxyphenyl)-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | COc1ccc(N2C(=S)NC(c3ccccn3)C2c2cc(C)n(-c3ccccc3Cl)c2C)cc1 |
| InChI | InChI=1S/C27H25ClN4OS/c1-17-16-21(18(2)31(17)24-10-5-4-8-22(24)28)26-25(23-9-6-7-15-29-23)30-27(34)32(26)19-11-13-20(33-3)14-12-19/h4-16,25-26H,1-3H3,(H,30,34) |
| InChIKey | BVMQDPNOQKMDPE-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 42.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.04 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|