C29H29ClN4O2S — CID 133156198
5-[1-(5-chloro-2-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]-1-(4-ethoxyphenyl)-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 133156198) has the molecular formula C29H29ClN4O2S and a molecular weight of 533.10 g/mol. Its IUPAC name is 5-[1-(5-chloro-2-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]-1-(4-ethoxyphenyl)-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | 5-[1-(5-chloro-2-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]-1-(4-ethoxyphenyl)-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 133156198 |
| Molecular Formula | C29H29ClN4O2S |
| Molecular Weight | 533.10 g/mol |
| Exact Mass | 532.17 |
| IUPAC Name | 5-[1-(5-chloro-2-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]-1-(4-ethoxyphenyl)-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | CCOc1ccc(N2C(=S)NC(c3ccccn3)C2c2cc(C)n(-c3cc(Cl)ccc3OC)c2C)cc1 |
| InChI | InChI=1S/C29H29ClN4O2S/c1-5-36-22-12-10-21(11-13-22)34-28(27(32-29(34)37)24-8-6-7-15-31-24)23-16-18(2)33(19(23)3)25-17-20(30)9-14-26(25)35-4/h6-17,27-28H,5H2,1-4H3,(H,32,37) |
| InChIKey | RRQURWNNUWVKCJ-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 51.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.10 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|