C32H30N4OS — CID 133156156
5-(2,5-dimethyl-1-naphthalen-1-ylpyrrol-3-yl)-1-(4-ethoxyphenyl)-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 133156156) has the molecular formula C32H30N4OS and a molecular weight of 518.69 g/mol. Its IUPAC name is 5-(2,5-dimethyl-1-naphthalen-1-ylpyrrol-3-yl)-1-(4-ethoxyphenyl)-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | 5-(2,5-dimethyl-1-naphthalen-1-ylpyrrol-3-yl)-1-(4-ethoxyphenyl)-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 133156156 |
| Molecular Formula | C32H30N4OS |
| Molecular Weight | 518.69 g/mol |
| Exact Mass | 518.21 |
| IUPAC Name | 5-(2,5-dimethyl-1-naphthalen-1-ylpyrrol-3-yl)-1-(4-ethoxyphenyl)-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | CCOc1ccc(N2C(=S)NC(c3ccccn3)C2c2cc(C)n(-c3cccc4ccccc34)c2C)cc1 |
| InChI | InChI=1S/C32H30N4OS/c1-4-37-25-17-15-24(16-18-25)36-31(30(34-32(36)38)28-13-7-8-19-33-28)27-20-21(2)35(22(27)3)29-14-9-11-23-10-5-6-12-26(23)29/h5-20,30-31H,4H2,1-3H3,(H,34,38) |
| InChIKey | FPQZZDBLBRCOCK-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 42.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.69 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|