C31H34N4OS — CID 133156200
1-(4-ethoxyphenyl)-5-[1-(2-ethyl-6-methylphenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 133156200) has the molecular formula C31H34N4OS and a molecular weight of 510.71 g/mol. Its IUPAC name is 1-(4-ethoxyphenyl)-5-[1-(2-ethyl-6-methylphenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | 1-(4-ethoxyphenyl)-5-[1-(2-ethyl-6-methylphenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 133156200 |
| Molecular Formula | C31H34N4OS |
| Molecular Weight | 510.71 g/mol |
| Exact Mass | 510.25 |
| IUPAC Name | 1-(4-ethoxyphenyl)-5-[1-(2-ethyl-6-methylphenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | CCOc1ccc(N2C(=S)NC(c3ccccn3)C2c2cc(C)n(-c3c(C)cccc3CC)c2C)cc1 |
| InChI | InChI=1S/C31H34N4OS/c1-6-23-12-10-11-20(3)29(23)34-21(4)19-26(22(34)5)30-28(27-13-8-9-18-32-27)33-31(37)35(30)24-14-16-25(17-15-24)36-7-2/h8-19,28,30H,6-7H2,1-5H3,(H,33,37) |
| InChIKey | HZDQYDLUJHDXNW-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 42.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.71 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|