C30H33N5O2S2 — CID 100616913
N-[4-[(4S,5S)-5-[1-(2-ethyl-6-methylphenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]phenyl]methanesulfonamide (PubChem CID 100616913) has the molecular formula C30H33N5O2S2 and a molecular weight of 559.76 g/mol. Its IUPAC name is N-[4-[(4S,5S)-5-[1-(2-ethyl-6-methylphenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]phenyl]methanesulfonamide.
| Compound Name | N-[4-[(4S,5S)-5-[1-(2-ethyl-6-methylphenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 100616913 |
| Molecular Formula | C30H33N5O2S2 |
| Molecular Weight | 559.76 g/mol |
| Exact Mass | 559.21 |
| IUPAC Name | N-[4-[(4S,5S)-5-[1-(2-ethyl-6-methylphenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]phenyl]methanesulfonamide |
| SMILES | CCc1cccc(C)c1-n1c(C)cc([C@H]2[C@@H](c3ccccn3)NC(=S)N2c2ccc(NS(C)(=O)=O)cc2)c1C |
| InChI | InChI=1S/C30H33N5O2S2/c1-6-22-11-9-10-19(2)28(22)34-20(3)18-25(21(34)4)29-27(26-12-7-8-17-31-26)32-30(38)35(29)24-15-13-23(14-16-24)33-39(5,36)37/h7-18,27,29,33H,6H2,1-5H3,(H,32,38)/t27-,29+/m1/s1 |
| InChIKey | ZHYSEVRESWOEKB-PXJZQJOASA-N |
| XLogP | 5.91 |
| TPSA | 79.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.76 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|