C30H31BrN4S — CID 100507641
(4R,5R)-1-(4-bromo-3-methylphenyl)-5-[1-(2-ethyl-6-methylphenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 100507641) has the molecular formula C30H31BrN4S and a molecular weight of 559.58 g/mol. Its IUPAC name is (4R,5R)-1-(4-bromo-3-methylphenyl)-5-[1-(2-ethyl-6-methylphenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | (4R,5R)-1-(4-bromo-3-methylphenyl)-5-[1-(2-ethyl-6-methylphenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 100507641 |
| Molecular Formula | C30H31BrN4S |
| Molecular Weight | 559.58 g/mol |
| Exact Mass | 558.15 |
| IUPAC Name | (4R,5R)-1-(4-bromo-3-methylphenyl)-5-[1-(2-ethyl-6-methylphenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | CCc1cccc(C)c1-n1c(C)cc([C@@H]2[C@H](c3ccccn3)NC(=S)N2c2ccc(Br)c(C)c2)c1C |
| InChI | InChI=1S/C30H31BrN4S/c1-6-22-11-9-10-18(2)28(22)34-20(4)17-24(21(34)5)29-27(26-12-7-8-15-32-26)33-30(36)35(29)23-13-14-25(31)19(3)16-23/h7-17,27,29H,6H2,1-5H3,(H,33,36)/t27-,29+/m0/s1 |
| InChIKey | QTXHBMMXVYRFAN-LMSSTIIKSA-N |
| XLogP | 7.61 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.58 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|