C32H36N4OS — CID 133244035
5-[1-(2-ethyl-6-methylphenyl)-2,5-dimethylpyrrol-3-yl]-1-(4-propan-2-yloxyphenyl)-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 133244035) has the molecular formula C32H36N4OS and a molecular weight of 524.73 g/mol. Its IUPAC name is 5-[1-(2-ethyl-6-methylphenyl)-2,5-dimethylpyrrol-3-yl]-1-(4-propan-2-yloxyphenyl)-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | 5-[1-(2-ethyl-6-methylphenyl)-2,5-dimethylpyrrol-3-yl]-1-(4-propan-2-yloxyphenyl)-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 133244035 |
| Molecular Formula | C32H36N4OS |
| Molecular Weight | 524.73 g/mol |
| Exact Mass | 524.26 |
| IUPAC Name | 5-[1-(2-ethyl-6-methylphenyl)-2,5-dimethylpyrrol-3-yl]-1-(4-propan-2-yloxyphenyl)-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | CCc1cccc(C)c1-n1c(C)cc(C2C(c3ccccn3)NC(=S)N2c2ccc(OC(C)C)cc2)c1C |
| InChI | InChI=1S/C32H36N4OS/c1-7-24-12-10-11-21(4)30(24)35-22(5)19-27(23(35)6)31-29(28-13-8-9-18-33-28)34-32(38)36(31)25-14-16-26(17-15-25)37-20(2)3/h8-20,29,31H,7H2,1-6H3,(H,34,38) |
| InChIKey | YDFGJOCMXPQJIR-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 42.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.73 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|