C32H36N4OS — CID 100600004
(4S,5R)-5-[2,5-dimethyl-1-(2,4,6-trimethylphenyl)pyrrol-3-yl]-1-(4-propan-2-yloxyphenyl)-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 100600004) has the molecular formula C32H36N4OS and a molecular weight of 524.73 g/mol. Its IUPAC name is (4S,5R)-5-[2,5-dimethyl-1-(2,4,6-trimethylphenyl)pyrrol-3-yl]-1-(4-propan-2-yloxyphenyl)-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | (4S,5R)-5-[2,5-dimethyl-1-(2,4,6-trimethylphenyl)pyrrol-3-yl]-1-(4-propan-2-yloxyphenyl)-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 100600004 |
| Molecular Formula | C32H36N4OS |
| Molecular Weight | 524.73 g/mol |
| Exact Mass | 524.26 |
| IUPAC Name | (4S,5R)-5-[2,5-dimethyl-1-(2,4,6-trimethylphenyl)pyrrol-3-yl]-1-(4-propan-2-yloxyphenyl)-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | Cc1cc(C)c(-n2c(C)cc([C@@H]3[C@@H](c4ccccn4)NC(=S)N3c3ccc(OC(C)C)cc3)c2C)c(C)c1 |
| InChI | InChI=1S/C32H36N4OS/c1-19(2)37-26-13-11-25(12-14-26)36-31(29(34-32(36)38)28-10-8-9-15-33-28)27-18-23(6)35(24(27)7)30-21(4)16-20(3)17-22(30)5/h8-19,29,31H,1-7H3,(H,34,38)/t29-,31-/m1/s1 |
| InChIKey | GRWYIAJWORPCSD-BVRKHOPBSA-N |
| XLogP | 7.38 |
| TPSA | 42.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.73 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|