C31H34N4OS — CID 100599909
(4S,5R)-5-[1-(3,5-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]-1-(4-propan-2-yloxyphenyl)-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 100599909) has the molecular formula C31H34N4OS and a molecular weight of 510.71 g/mol. Its IUPAC name is (4S,5R)-5-[1-(3,5-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]-1-(4-propan-2-yloxyphenyl)-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | (4S,5R)-5-[1-(3,5-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]-1-(4-propan-2-yloxyphenyl)-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 100599909 |
| Molecular Formula | C31H34N4OS |
| Molecular Weight | 510.71 g/mol |
| Exact Mass | 510.25 |
| IUPAC Name | (4S,5R)-5-[1-(3,5-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]-1-(4-propan-2-yloxyphenyl)-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | Cc1cc(C)cc(-n2c(C)cc([C@@H]3[C@@H](c4ccccn4)NC(=S)N3c3ccc(OC(C)C)cc3)c2C)c1 |
| InChI | InChI=1S/C31H34N4OS/c1-19(2)36-26-12-10-24(11-13-26)35-30(29(33-31(35)37)28-9-7-8-14-32-28)27-18-22(5)34(23(27)6)25-16-20(3)15-21(4)17-25/h7-19,29-30H,1-6H3,(H,33,37)/t29-,30-/m1/s1 |
| InChIKey | OMRTWRQXAOAGOH-LOYHVIPDSA-N |
| XLogP | 7.07 |
| TPSA | 42.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.71 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|