C29H32N6O2S2 — CID 100615640
N-[4-[(4R,5S)-5-[1-[4-(dimethylamino)phenyl]-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]phenyl]methanesulfonamide (PubChem CID 100615640) has the molecular formula C29H32N6O2S2 and a molecular weight of 560.75 g/mol. Its IUPAC name is N-[4-[(4R,5S)-5-[1-[4-(dimethylamino)phenyl]-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]phenyl]methanesulfonamide.
| Compound Name | N-[4-[(4R,5S)-5-[1-[4-(dimethylamino)phenyl]-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 100615640 |
| Molecular Formula | C29H32N6O2S2 |
| Molecular Weight | 560.75 g/mol |
| Exact Mass | 560.20 |
| IUPAC Name | N-[4-[(4R,5S)-5-[1-[4-(dimethylamino)phenyl]-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]phenyl]methanesulfonamide |
| SMILES | Cc1cc([C@H]2[C@H](c3ccccn3)NC(=S)N2c2ccc(NS(C)(=O)=O)cc2)c(C)n1-c1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C29H32N6O2S2/c1-19-18-25(20(2)34(19)23-15-13-22(14-16-23)33(3)4)28-27(26-8-6-7-17-30-26)31-29(38)35(28)24-11-9-21(10-12-24)32-39(5,36)37/h6-18,27-28,32H,1-5H3,(H,31,38)/t27-,28-/m0/s1 |
| InChIKey | IFAVRXOQIQAIKY-NSOVKSMOSA-N |
| XLogP | 5.10 |
| TPSA | 82.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.75 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|