C28H29N5OS — CID 133156349
5-[1-[4-(dimethylamino)phenyl]-2,5-dimethylpyrrol-3-yl]-1-(4-hydroxyphenyl)-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 133156349) has the molecular formula C28H29N5OS and a molecular weight of 483.64 g/mol. Its IUPAC name is 5-[1-[4-(dimethylamino)phenyl]-2,5-dimethylpyrrol-3-yl]-1-(4-hydroxyphenyl)-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | 5-[1-[4-(dimethylamino)phenyl]-2,5-dimethylpyrrol-3-yl]-1-(4-hydroxyphenyl)-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 133156349 |
| Molecular Formula | C28H29N5OS |
| Molecular Weight | 483.64 g/mol |
| Exact Mass | 483.21 |
| IUPAC Name | 5-[1-[4-(dimethylamino)phenyl]-2,5-dimethylpyrrol-3-yl]-1-(4-hydroxyphenyl)-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | Cc1cc(C2C(c3ccccn3)NC(=S)N2c2ccc(O)cc2)c(C)n1-c1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C28H29N5OS/c1-18-17-24(19(2)32(18)21-10-8-20(9-11-21)31(3)4)27-26(25-7-5-6-16-29-25)30-28(35)33(27)22-12-14-23(34)15-13-22/h5-17,26-27,34H,1-4H3,(H,30,35) |
| InChIKey | OZJHSWLGXILRRV-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 56.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.64 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|