C28H28BrN5S — CID 133156506
5-[1-(2-bromophenyl)-2,5-dimethylpyrrol-3-yl]-1-[4-(dimethylamino)phenyl]-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 133156506) has the molecular formula C28H28BrN5S and a molecular weight of 546.54 g/mol. Its IUPAC name is 5-[1-(2-bromophenyl)-2,5-dimethylpyrrol-3-yl]-1-[4-(dimethylamino)phenyl]-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | 5-[1-(2-bromophenyl)-2,5-dimethylpyrrol-3-yl]-1-[4-(dimethylamino)phenyl]-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 133156506 |
| Molecular Formula | C28H28BrN5S |
| Molecular Weight | 546.54 g/mol |
| Exact Mass | 545.12 |
| IUPAC Name | 5-[1-(2-bromophenyl)-2,5-dimethylpyrrol-3-yl]-1-[4-(dimethylamino)phenyl]-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | Cc1cc(C2C(c3ccccn3)NC(=S)N2c2ccc(N(C)C)cc2)c(C)n1-c1ccccc1Br |
| InChI | InChI=1S/C28H28BrN5S/c1-18-17-22(19(2)33(18)25-11-6-5-9-23(25)29)27-26(24-10-7-8-16-30-24)31-28(35)34(27)21-14-12-20(13-15-21)32(3)4/h5-17,26-27H,1-4H3,(H,31,35) |
| InChIKey | MJJUFQNGPPPMRS-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 36.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.54 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|