C25H31N5S — CID 133156487
1-[4-(dimethylamino)phenyl]-5-(2,5-dimethyl-1-propan-2-ylpyrrol-3-yl)-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 133156487) has the molecular formula C25H31N5S and a molecular weight of 433.63 g/mol. Its IUPAC name is 1-[4-(dimethylamino)phenyl]-5-(2,5-dimethyl-1-propan-2-ylpyrrol-3-yl)-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | 1-[4-(dimethylamino)phenyl]-5-(2,5-dimethyl-1-propan-2-ylpyrrol-3-yl)-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 133156487 |
| Molecular Formula | C25H31N5S |
| Molecular Weight | 433.63 g/mol |
| Exact Mass | 433.23 |
| IUPAC Name | 1-[4-(dimethylamino)phenyl]-5-(2,5-dimethyl-1-propan-2-ylpyrrol-3-yl)-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | Cc1cc(C2C(c3ccccn3)NC(=S)N2c2ccc(N(C)C)cc2)c(C)n1C(C)C |
| InChI | InChI=1S/C25H31N5S/c1-16(2)29-17(3)15-21(18(29)4)24-23(22-9-7-8-14-26-22)27-25(31)30(24)20-12-10-19(11-13-20)28(5)6/h7-16,23-24H,1-6H3,(H,27,31) |
| InChIKey | WQBWKDLKFJONJH-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 36.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.63 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|