C30H34N6O3S2 — CID 133208181
N-[5-[5-[1-[4-(dimethylamino)phenyl]-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-2-methoxyphenyl]methanesulfonamide (PubChem CID 133208181) has the molecular formula C30H34N6O3S2 and a molecular weight of 590.78 g/mol. Its IUPAC name is N-[5-[5-[1-[4-(dimethylamino)phenyl]-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-2-methoxyphenyl]methanesulfonamide.
| Compound Name | N-[5-[5-[1-[4-(dimethylamino)phenyl]-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-2-methoxyphenyl]methanesulfonamide |
|---|---|
| PubChem CID | 133208181 |
| Molecular Formula | C30H34N6O3S2 |
| Molecular Weight | 590.78 g/mol |
| Exact Mass | 590.21 |
| IUPAC Name | N-[5-[5-[1-[4-(dimethylamino)phenyl]-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-2-methoxyphenyl]methanesulfonamide |
| SMILES | COc1ccc(N2C(=S)NC(c3ccccn3)C2c2cc(C)n(-c3ccc(N(C)C)cc3)c2C)cc1NS(C)(=O)=O |
| InChI | InChI=1S/C30H34N6O3S2/c1-19-17-24(20(2)35(19)22-12-10-21(11-13-22)34(3)4)29-28(25-9-7-8-16-31-25)32-30(40)36(29)23-14-15-27(39-5)26(18-23)33-41(6,37)38/h7-18,28-29,33H,1-6H3,(H,32,40) |
| InChIKey | DTIUMPALDFIDPV-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 91.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.78 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|