C32H36N6O3S — CID 133243678
N-[5-[5-[1-[4-(dimethylamino)phenyl]-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-2-methoxyphenyl]-2-methoxyacetamide (PubChem CID 133243678) has the molecular formula C32H36N6O3S and a molecular weight of 584.75 g/mol. Its IUPAC name is N-[5-[5-[1-[4-(dimethylamino)phenyl]-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-2-methoxyphenyl]-2-methoxyacetamide.
| Compound Name | N-[5-[5-[1-[4-(dimethylamino)phenyl]-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-2-methoxyphenyl]-2-methoxyacetamide |
|---|---|
| PubChem CID | 133243678 |
| Molecular Formula | C32H36N6O3S |
| Molecular Weight | 584.75 g/mol |
| Exact Mass | 584.26 |
| IUPAC Name | N-[5-[5-[1-[4-(dimethylamino)phenyl]-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-2-methoxyphenyl]-2-methoxyacetamide |
| SMILES | COCC(=O)Nc1cc(N2C(=S)NC(c3ccccn3)C2c2cc(C)n(-c3ccc(N(C)C)cc3)c2C)ccc1OC |
| InChI | InChI=1S/C32H36N6O3S/c1-20-17-25(21(2)37(20)23-12-10-22(11-13-23)36(3)4)31-30(26-9-7-8-16-33-26)35-32(42)38(31)24-14-15-28(41-6)27(18-24)34-29(39)19-40-5/h7-18,30-31H,19H2,1-6H3,(H,34,39)(H,35,42) |
| InChIKey | HFRRUIYCIOHXKU-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 83.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.75 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|