C34H40N6O3S — CID 100587545
N-[5-[(4R,5R)-5-[1-[4-(diethylamino)phenyl]-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-2-methoxyphenyl]-2-methoxyacetamide (PubChem CID 100587545) has the molecular formula C34H40N6O3S and a molecular weight of 612.80 g/mol. Its IUPAC name is N-[5-[(4R,5R)-5-[1-[4-(diethylamino)phenyl]-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-2-methoxyphenyl]-2-methoxyacetamide.
| Compound Name | N-[5-[(4R,5R)-5-[1-[4-(diethylamino)phenyl]-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-2-methoxyphenyl]-2-methoxyacetamide |
|---|---|
| PubChem CID | 100587545 |
| Molecular Formula | C34H40N6O3S |
| Molecular Weight | 612.80 g/mol |
| Exact Mass | 612.29 |
| IUPAC Name | N-[5-[(4R,5R)-5-[1-[4-(diethylamino)phenyl]-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-2-methoxyphenyl]-2-methoxyacetamide |
| SMILES | CCN(CC)c1ccc(-n2c(C)cc([C@@H]3[C@H](c4ccccn4)NC(=S)N3c3ccc(OC)c(NC(=O)COC)c3)c2C)cc1 |
| InChI | InChI=1S/C34H40N6O3S/c1-7-38(8-2)24-12-14-25(15-13-24)39-22(3)19-27(23(39)4)33-32(28-11-9-10-18-35-28)37-34(44)40(33)26-16-17-30(43-6)29(20-26)36-31(41)21-42-5/h9-20,32-33H,7-8,21H2,1-6H3,(H,36,41)(H,37,44)/t32-,33+/m0/s1 |
| InChIKey | SHUDQFLXSDBCLS-JHOUSYSJSA-N |
| XLogP | 6.11 |
| TPSA | 83.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.80 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|