C30H31N5O4S — CID 133243669
N-[5-[5-[1-(4-hydroxyphenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-2-methoxyphenyl]-2-methoxyacetamide (PubChem CID 133243669) has the molecular formula C30H31N5O4S and a molecular weight of 557.68 g/mol. Its IUPAC name is N-[5-[5-[1-(4-hydroxyphenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-2-methoxyphenyl]-2-methoxyacetamide.
| Compound Name | N-[5-[5-[1-(4-hydroxyphenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-2-methoxyphenyl]-2-methoxyacetamide |
|---|---|
| PubChem CID | 133243669 |
| Molecular Formula | C30H31N5O4S |
| Molecular Weight | 557.68 g/mol |
| Exact Mass | 557.21 |
| IUPAC Name | N-[5-[5-[1-(4-hydroxyphenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-2-methoxyphenyl]-2-methoxyacetamide |
| SMILES | COCC(=O)Nc1cc(N2C(=S)NC(c3ccccn3)C2c2cc(C)n(-c3ccc(O)cc3)c2C)ccc1OC |
| InChI | InChI=1S/C30H31N5O4S/c1-18-15-23(19(2)34(18)20-8-11-22(36)12-9-20)29-28(24-7-5-6-14-31-24)33-30(40)35(29)21-10-13-26(39-4)25(16-21)32-27(37)17-38-3/h5-16,28-29,36H,17H2,1-4H3,(H,32,37)(H,33,40) |
| InChIKey | OPYPGCWOGBLULA-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 100.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.68 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|