C34H33N5O3S — CID 100586543
N-[5-[(4R,5S)-5-(2,5-dimethyl-1-naphthalen-1-ylpyrrol-3-yl)-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-2-methoxyphenyl]-2-methoxyacetamide (PubChem CID 100586543) has the molecular formula C34H33N5O3S and a molecular weight of 591.74 g/mol. Its IUPAC name is N-[5-[(4R,5S)-5-(2,5-dimethyl-1-naphthalen-1-ylpyrrol-3-yl)-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-2-methoxyphenyl]-2-methoxyacetamide.
| Compound Name | N-[5-[(4R,5S)-5-(2,5-dimethyl-1-naphthalen-1-ylpyrrol-3-yl)-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-2-methoxyphenyl]-2-methoxyacetamide |
|---|---|
| PubChem CID | 100586543 |
| Molecular Formula | C34H33N5O3S |
| Molecular Weight | 591.74 g/mol |
| Exact Mass | 591.23 |
| IUPAC Name | N-[5-[(4R,5S)-5-(2,5-dimethyl-1-naphthalen-1-ylpyrrol-3-yl)-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-2-methoxyphenyl]-2-methoxyacetamide |
| SMILES | COCC(=O)Nc1cc(N2C(=S)N[C@@H](c3ccccn3)[C@@H]2c2cc(C)n(-c3cccc4ccccc34)c2C)ccc1OC |
| InChI | InChI=1S/C34H33N5O3S/c1-21-18-26(22(2)38(21)29-14-9-11-23-10-5-6-12-25(23)29)33-32(27-13-7-8-17-35-27)37-34(43)39(33)24-15-16-30(42-4)28(19-24)36-31(40)20-41-3/h5-19,32-33H,20H2,1-4H3,(H,36,40)(H,37,43)/t32-,33-/m0/s1 |
| InChIKey | LFRYMZZEAZGWPM-LQJZCPKCSA-N |
| XLogP | 6.41 |
| TPSA | 80.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.74 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|