C31H32N6O6S — CID 100587899
2-methoxy-N-[2-methoxy-5-[(4S,5S)-5-[1-(2-methoxy-4-nitrophenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]phenyl]acetamide (PubChem CID 100587899) has the molecular formula C31H32N6O6S and a molecular weight of 616.70 g/mol. Its IUPAC name is 2-methoxy-N-[2-methoxy-5-[(4S,5S)-5-[1-(2-methoxy-4-nitrophenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]phenyl]acetamide.
| Compound Name | 2-methoxy-N-[2-methoxy-5-[(4S,5S)-5-[1-(2-methoxy-4-nitrophenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 100587899 |
| Molecular Formula | C31H32N6O6S |
| Molecular Weight | 616.70 g/mol |
| Exact Mass | 616.21 |
| IUPAC Name | 2-methoxy-N-[2-methoxy-5-[(4S,5S)-5-[1-(2-methoxy-4-nitrophenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]phenyl]acetamide |
| SMILES | COCC(=O)Nc1cc(N2C(=S)N[C@H](c3ccccn3)[C@@H]2c2cc(C)n(-c3ccc([N+](=O)[O-])cc3OC)c2C)ccc1OC |
| InChI | InChI=1S/C31H32N6O6S/c1-18-14-22(19(2)35(18)25-11-9-21(37(39)40)16-27(25)43-5)30-29(23-8-6-7-13-32-23)34-31(44)36(30)20-10-12-26(42-4)24(15-20)33-28(38)17-41-3/h6-16,29-30H,17H2,1-5H3,(H,33,38)(H,34,44)/t29-,30+/m1/s1 |
| InChIKey | RGQYTLCXXJBYKD-IHLOFXLRSA-N |
| XLogP | 5.18 |
| TPSA | 133.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.70 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|