C30H30N6O5S — CID 100593513
N-[2-methoxy-5-[(4S,5R)-5-[1-(2-methoxy-4-nitrophenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]phenyl]acetamide (PubChem CID 100593513) has the molecular formula C30H30N6O5S and a molecular weight of 586.67 g/mol. Its IUPAC name is N-[2-methoxy-5-[(4S,5R)-5-[1-(2-methoxy-4-nitrophenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]phenyl]acetamide.
| Compound Name | N-[2-methoxy-5-[(4S,5R)-5-[1-(2-methoxy-4-nitrophenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 100593513 |
| Molecular Formula | C30H30N6O5S |
| Molecular Weight | 586.67 g/mol |
| Exact Mass | 586.20 |
| IUPAC Name | N-[2-methoxy-5-[(4S,5R)-5-[1-(2-methoxy-4-nitrophenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]phenyl]acetamide |
| SMILES | COc1ccc(N2C(=S)N[C@H](c3ccccn3)[C@H]2c2cc(C)n(-c3ccc([N+](=O)[O-])cc3OC)c2C)cc1NC(C)=O |
| InChI | InChI=1S/C30H30N6O5S/c1-17-14-22(18(2)34(17)25-11-9-21(36(38)39)16-27(25)41-5)29-28(23-8-6-7-13-31-23)33-30(42)35(29)20-10-12-26(40-4)24(15-20)32-19(3)37/h6-16,28-29H,1-5H3,(H,32,37)(H,33,42)/t28-,29-/m1/s1 |
| InChIKey | QZQPUVJWDUQXSB-FQLXRVMXSA-N |
| XLogP | 5.55 |
| TPSA | 123.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.67 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|