C29H30N6O6S2 — CID 100629392
N-[2-methoxy-4-[(4S,5S)-5-[1-(2-methoxy-4-nitrophenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]phenyl]methanesulfonamide (PubChem CID 100629392) has the molecular formula C29H30N6O6S2 and a molecular weight of 622.73 g/mol. Its IUPAC name is N-[2-methoxy-4-[(4S,5S)-5-[1-(2-methoxy-4-nitrophenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]phenyl]methanesulfonamide.
| Compound Name | N-[2-methoxy-4-[(4S,5S)-5-[1-(2-methoxy-4-nitrophenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 100629392 |
| Molecular Formula | C29H30N6O6S2 |
| Molecular Weight | 622.73 g/mol |
| Exact Mass | 622.17 |
| IUPAC Name | N-[2-methoxy-4-[(4S,5S)-5-[1-(2-methoxy-4-nitrophenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]phenyl]methanesulfonamide |
| SMILES | COc1cc(N2C(=S)N[C@H](c3ccccn3)[C@@H]2c2cc(C)n(-c3ccc([N+](=O)[O-])cc3OC)c2C)ccc1NS(C)(=O)=O |
| InChI | InChI=1S/C29H30N6O6S2/c1-17-14-21(18(2)33(17)24-12-10-20(35(36)37)16-26(24)41-4)28-27(23-8-6-7-13-30-23)31-29(42)34(28)19-9-11-22(25(15-19)40-3)32-43(5,38)39/h6-16,27-28,32H,1-5H3,(H,31,42)/t27-,28+/m1/s1 |
| InChIKey | IWGHCJKJWFOXIG-IZLXSDGUSA-N |
| XLogP | 4.96 |
| TPSA | 140.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.73 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|