C29H31N5O3S2 — CID 133207821
N-[4-[5-[2,5-dimethyl-1-(3-methylphenyl)pyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-2-methoxyphenyl]methanesulfonamide (PubChem CID 133207821) has the molecular formula C29H31N5O3S2 and a molecular weight of 561.73 g/mol. Its IUPAC name is N-[4-[5-[2,5-dimethyl-1-(3-methylphenyl)pyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-2-methoxyphenyl]methanesulfonamide.
| Compound Name | N-[4-[5-[2,5-dimethyl-1-(3-methylphenyl)pyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-2-methoxyphenyl]methanesulfonamide |
|---|---|
| PubChem CID | 133207821 |
| Molecular Formula | C29H31N5O3S2 |
| Molecular Weight | 561.73 g/mol |
| Exact Mass | 561.19 |
| IUPAC Name | N-[4-[5-[2,5-dimethyl-1-(3-methylphenyl)pyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-2-methoxyphenyl]methanesulfonamide |
| SMILES | COc1cc(N2C(=S)NC(c3ccccn3)C2c2cc(C)n(-c3cccc(C)c3)c2C)ccc1NS(C)(=O)=O |
| InChI | InChI=1S/C29H31N5O3S2/c1-18-9-8-10-21(15-18)33-19(2)16-23(20(33)3)28-27(25-11-6-7-14-30-25)31-29(38)34(28)22-12-13-24(26(17-22)37-4)32-39(5,35)36/h6-17,27-28,32H,1-5H3,(H,31,38) |
| InChIKey | NAKFJGCBSSHFBG-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 88.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.73 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|