C30H33N5O3S2 — CID 100627202
N-[4-[(4S,5S)-5-[1-(4-ethylphenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-2-methoxyphenyl]methanesulfonamide (PubChem CID 100627202) has the molecular formula C30H33N5O3S2 and a molecular weight of 575.76 g/mol. Its IUPAC name is N-[4-[(4S,5S)-5-[1-(4-ethylphenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-2-methoxyphenyl]methanesulfonamide.
| Compound Name | N-[4-[(4S,5S)-5-[1-(4-ethylphenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-2-methoxyphenyl]methanesulfonamide |
|---|---|
| PubChem CID | 100627202 |
| Molecular Formula | C30H33N5O3S2 |
| Molecular Weight | 575.76 g/mol |
| Exact Mass | 575.20 |
| IUPAC Name | N-[4-[(4S,5S)-5-[1-(4-ethylphenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-2-methoxyphenyl]methanesulfonamide |
| SMILES | CCc1ccc(-n2c(C)cc([C@H]3[C@@H](c4ccccn4)NC(=S)N3c3ccc(NS(C)(=O)=O)c(OC)c3)c2C)cc1 |
| InChI | InChI=1S/C30H33N5O3S2/c1-6-21-10-12-22(13-11-21)34-19(2)17-24(20(34)3)29-28(26-9-7-8-16-31-26)32-30(39)35(29)23-14-15-25(27(18-23)38-4)33-40(5,36)37/h7-18,28-29,33H,6H2,1-5H3,(H,32,39)/t28-,29+/m1/s1 |
| InChIKey | JSGGVERVHYLYNU-WDYNHAJCSA-N |
| XLogP | 5.61 |
| TPSA | 88.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.76 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|