C32H38N6O3S2 — CID 100628503
N-[4-[(4R,5S)-5-[1-[4-(diethylamino)phenyl]-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-2-methoxyphenyl]methanesulfonamide (PubChem CID 100628503) has the molecular formula C32H38N6O3S2 and a molecular weight of 618.83 g/mol. Its IUPAC name is N-[4-[(4R,5S)-5-[1-[4-(diethylamino)phenyl]-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-2-methoxyphenyl]methanesulfonamide.
| Compound Name | N-[4-[(4R,5S)-5-[1-[4-(diethylamino)phenyl]-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-2-methoxyphenyl]methanesulfonamide |
|---|---|
| PubChem CID | 100628503 |
| Molecular Formula | C32H38N6O3S2 |
| Molecular Weight | 618.83 g/mol |
| Exact Mass | 618.24 |
| IUPAC Name | N-[4-[(4R,5S)-5-[1-[4-(diethylamino)phenyl]-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-2-methoxyphenyl]methanesulfonamide |
| SMILES | CCN(CC)c1ccc(-n2c(C)cc([C@H]3[C@H](c4ccccn4)NC(=S)N3c3ccc(NS(C)(=O)=O)c(OC)c3)c2C)cc1 |
| InChI | InChI=1S/C32H38N6O3S2/c1-7-36(8-2)23-12-14-24(15-13-23)37-21(3)19-26(22(37)4)31-30(28-11-9-10-18-33-28)34-32(42)38(31)25-16-17-27(29(20-25)41-5)35-43(6,39)40/h9-20,30-31,35H,7-8H2,1-6H3,(H,34,42)/t30-,31-/m0/s1 |
| InChIKey | PTVYNSPXEIHDPG-CONSDPRKSA-N |
| XLogP | 5.89 |
| TPSA | 91.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.83 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|