C34H31N5O4S — CID 133183758
5-[1-(2-methoxy-4-nitrophenyl)-2,5-dimethylpyrrol-3-yl]-1-[4-(4-methylphenoxy)phenyl]-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 133183758) has the molecular formula C34H31N5O4S and a molecular weight of 605.72 g/mol. Its IUPAC name is 5-[1-(2-methoxy-4-nitrophenyl)-2,5-dimethylpyrrol-3-yl]-1-[4-(4-methylphenoxy)phenyl]-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | 5-[1-(2-methoxy-4-nitrophenyl)-2,5-dimethylpyrrol-3-yl]-1-[4-(4-methylphenoxy)phenyl]-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 133183758 |
| Molecular Formula | C34H31N5O4S |
| Molecular Weight | 605.72 g/mol |
| Exact Mass | 605.21 |
| IUPAC Name | 5-[1-(2-methoxy-4-nitrophenyl)-2,5-dimethylpyrrol-3-yl]-1-[4-(4-methylphenoxy)phenyl]-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | COc1cc([N+](=O)[O-])ccc1-n1c(C)cc(C2C(c3ccccn3)NC(=S)N2c2ccc(Oc3ccc(C)cc3)cc2)c1C |
| InChI | InChI=1S/C34H31N5O4S/c1-21-8-13-26(14-9-21)43-27-15-10-24(11-16-27)38-33(32(36-34(38)44)29-7-5-6-18-35-29)28-19-22(2)37(23(28)3)30-17-12-25(39(40)41)20-31(30)42-4/h5-20,32-33H,1-4H3,(H,36,44) |
| InChIKey | COSOTIWOGCZPJC-UHFFFAOYSA-N |
| XLogP | 7.68 |
| TPSA | 94.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.72 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|