C27H24FN5O3S — CID 133182255
1-(4-fluorophenyl)-5-[1-(2-methoxy-5-nitrophenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 133182255) has the molecular formula C27H24FN5O3S and a molecular weight of 517.59 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-5-[1-(2-methoxy-5-nitrophenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | 1-(4-fluorophenyl)-5-[1-(2-methoxy-5-nitrophenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 133182255 |
| Molecular Formula | C27H24FN5O3S |
| Molecular Weight | 517.59 g/mol |
| Exact Mass | 517.16 |
| IUPAC Name | 1-(4-fluorophenyl)-5-[1-(2-methoxy-5-nitrophenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | COc1ccc([N+](=O)[O-])cc1-n1c(C)cc(C2C(c3ccccn3)NC(=S)N2c2ccc(F)cc2)c1C |
| InChI | InChI=1S/C27H24FN5O3S/c1-16-14-21(17(2)31(16)23-15-20(33(34)35)11-12-24(23)36-3)26-25(22-6-4-5-13-29-22)30-27(37)32(26)19-9-7-18(28)8-10-19/h4-15,25-26H,1-3H3,(H,30,37) |
| InChIKey | NMGVMHZKFYXCFJ-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 85.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.59 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|