C31H32N6O5S — CID 133242987
N-[2-methoxy-4-[5-[1-(2-methoxy-5-nitrophenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]phenyl]propanamide (PubChem CID 133242987) has the molecular formula C31H32N6O5S and a molecular weight of 600.70 g/mol. Its IUPAC name is N-[2-methoxy-4-[5-[1-(2-methoxy-5-nitrophenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]phenyl]propanamide.
| Compound Name | N-[2-methoxy-4-[5-[1-(2-methoxy-5-nitrophenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]phenyl]propanamide |
|---|---|
| PubChem CID | 133242987 |
| Molecular Formula | C31H32N6O5S |
| Molecular Weight | 600.70 g/mol |
| Exact Mass | 600.22 |
| IUPAC Name | N-[2-methoxy-4-[5-[1-(2-methoxy-5-nitrophenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]phenyl]propanamide |
| SMILES | CCC(=O)Nc1ccc(N2C(=S)NC(c3ccccn3)C2c2cc(C)n(-c3cc([N+](=O)[O-])ccc3OC)c2C)cc1OC |
| InChI | InChI=1S/C31H32N6O5S/c1-6-28(38)33-23-12-10-20(17-27(23)42-5)36-30(29(34-31(36)43)24-9-7-8-14-32-24)22-15-18(2)35(19(22)3)25-16-21(37(39)40)11-13-26(25)41-4/h7-17,29-30H,6H2,1-5H3,(H,33,38)(H,34,43) |
| InChIKey | BXEQOYHMVWNJNU-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 123.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.70 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|