C32H33N5O4S — CID 133243053
methyl 2-[3-[3-[3-methoxy-4-(propanoylamino)phenyl]-5-pyridin-2-yl-2-sulfanylideneimidazolidin-4-yl]-2,5-dimethylpyrrol-1-yl]benzoate (PubChem CID 133243053) has the molecular formula C32H33N5O4S and a molecular weight of 583.71 g/mol. Its IUPAC name is methyl 2-[3-[3-[3-methoxy-4-(propanoylamino)phenyl]-5-pyridin-2-yl-2-sulfanylideneimidazolidin-4-yl]-2,5-dimethylpyrrol-1-yl]benzoate.
| Compound Name | methyl 2-[3-[3-[3-methoxy-4-(propanoylamino)phenyl]-5-pyridin-2-yl-2-sulfanylideneimidazolidin-4-yl]-2,5-dimethylpyrrol-1-yl]benzoate |
|---|---|
| PubChem CID | 133243053 |
| Molecular Formula | C32H33N5O4S |
| Molecular Weight | 583.71 g/mol |
| Exact Mass | 583.23 |
| IUPAC Name | methyl 2-[3-[3-[3-methoxy-4-(propanoylamino)phenyl]-5-pyridin-2-yl-2-sulfanylideneimidazolidin-4-yl]-2,5-dimethylpyrrol-1-yl]benzoate |
| SMILES | CCC(=O)Nc1ccc(N2C(=S)NC(c3ccccn3)C2c2cc(C)n(-c3ccccc3C(=O)OC)c2C)cc1OC |
| InChI | InChI=1S/C32H33N5O4S/c1-6-28(38)34-24-15-14-21(18-27(24)40-4)37-30(29(35-32(37)42)25-12-9-10-16-33-25)23-17-19(2)36(20(23)3)26-13-8-7-11-22(26)31(39)41-5/h7-18,29-30H,6H2,1-5H3,(H,34,38)(H,35,42) |
| InChIKey | RUIXDKQDXXVKOL-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 97.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.71 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|