C27H25FN4S — CID 133182217
5-[2,5-dimethyl-1-(2-methylphenyl)pyrrol-3-yl]-1-(4-fluorophenyl)-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 133182217) has the molecular formula C27H25FN4S and a molecular weight of 456.59 g/mol. Its IUPAC name is 5-[2,5-dimethyl-1-(2-methylphenyl)pyrrol-3-yl]-1-(4-fluorophenyl)-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | 5-[2,5-dimethyl-1-(2-methylphenyl)pyrrol-3-yl]-1-(4-fluorophenyl)-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 133182217 |
| Molecular Formula | C27H25FN4S |
| Molecular Weight | 456.59 g/mol |
| Exact Mass | 456.18 |
| IUPAC Name | 5-[2,5-dimethyl-1-(2-methylphenyl)pyrrol-3-yl]-1-(4-fluorophenyl)-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | Cc1ccccc1-n1c(C)cc(C2C(c3ccccn3)NC(=S)N2c2ccc(F)cc2)c1C |
| InChI | InChI=1S/C27H25FN4S/c1-17-8-4-5-10-24(17)31-18(2)16-22(19(31)3)26-25(23-9-6-7-15-29-23)30-27(33)32(26)21-13-11-20(28)12-14-21/h4-16,25-26H,1-3H3,(H,30,33) |
| InChIKey | DDINZKWMUBSGRE-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.59 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|