C32H34N4OS — CID 100605830
(4R,5S)-1-(4-cyclopentyloxyphenyl)-5-[2,5-dimethyl-1-(2-methylphenyl)pyrrol-3-yl]-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 100605830) has the molecular formula C32H34N4OS and a molecular weight of 522.72 g/mol. Its IUPAC name is (4R,5S)-1-(4-cyclopentyloxyphenyl)-5-[2,5-dimethyl-1-(2-methylphenyl)pyrrol-3-yl]-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | (4R,5S)-1-(4-cyclopentyloxyphenyl)-5-[2,5-dimethyl-1-(2-methylphenyl)pyrrol-3-yl]-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 100605830 |
| Molecular Formula | C32H34N4OS |
| Molecular Weight | 522.72 g/mol |
| Exact Mass | 522.25 |
| IUPAC Name | (4R,5S)-1-(4-cyclopentyloxyphenyl)-5-[2,5-dimethyl-1-(2-methylphenyl)pyrrol-3-yl]-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | Cc1ccccc1-n1c(C)cc([C@H]2[C@H](c3ccccn3)NC(=S)N2c2ccc(OC3CCCC3)cc2)c1C |
| InChI | InChI=1S/C32H34N4OS/c1-21-10-4-7-14-29(21)35-22(2)20-27(23(35)3)31-30(28-13-8-9-19-33-28)34-32(38)36(31)24-15-17-26(18-16-24)37-25-11-5-6-12-25/h4,7-10,13-20,25,30-31H,5-6,11-12H2,1-3H3,(H,34,38)/t30-,31-/m0/s1 |
| InChIKey | AWXOUUQCBLEQJB-CONSDPRKSA-N |
| XLogP | 7.30 |
| TPSA | 42.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.72 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|