C31H31ClN4OS — CID 100606284
(4S,5R)-5-[1-(4-chlorophenyl)-2,5-dimethylpyrrol-3-yl]-1-(4-cyclopentyloxyphenyl)-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 100606284) has the molecular formula C31H31ClN4OS and a molecular weight of 543.14 g/mol. Its IUPAC name is (4S,5R)-5-[1-(4-chlorophenyl)-2,5-dimethylpyrrol-3-yl]-1-(4-cyclopentyloxyphenyl)-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | (4S,5R)-5-[1-(4-chlorophenyl)-2,5-dimethylpyrrol-3-yl]-1-(4-cyclopentyloxyphenyl)-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 100606284 |
| Molecular Formula | C31H31ClN4OS |
| Molecular Weight | 543.14 g/mol |
| Exact Mass | 542.19 |
| IUPAC Name | (4S,5R)-5-[1-(4-chlorophenyl)-2,5-dimethylpyrrol-3-yl]-1-(4-cyclopentyloxyphenyl)-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | Cc1cc([C@@H]2[C@@H](c3ccccn3)NC(=S)N2c2ccc(OC3CCCC3)cc2)c(C)n1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C31H31ClN4OS/c1-20-19-27(21(2)35(20)23-12-10-22(32)11-13-23)30-29(28-9-5-6-18-33-28)34-31(38)36(30)24-14-16-26(17-15-24)37-25-7-3-4-8-25/h5-6,9-19,25,29-30H,3-4,7-8H2,1-2H3,(H,34,38)/t29-,30-/m1/s1 |
| InChIKey | JIVUQALJDXRYAY-LOYHVIPDSA-N |
| XLogP | 7.64 |
| TPSA | 42.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.14 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|