C30H36N4OS — CID 100605558
(4S,5S)-5-(1-cyclopentyl-2,5-dimethylpyrrol-3-yl)-1-(4-cyclopentyloxyphenyl)-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 100605558) has the molecular formula C30H36N4OS and a molecular weight of 500.71 g/mol. Its IUPAC name is (4S,5S)-5-(1-cyclopentyl-2,5-dimethylpyrrol-3-yl)-1-(4-cyclopentyloxyphenyl)-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | (4S,5S)-5-(1-cyclopentyl-2,5-dimethylpyrrol-3-yl)-1-(4-cyclopentyloxyphenyl)-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 100605558 |
| Molecular Formula | C30H36N4OS |
| Molecular Weight | 500.71 g/mol |
| Exact Mass | 500.26 |
| IUPAC Name | (4S,5S)-5-(1-cyclopentyl-2,5-dimethylpyrrol-3-yl)-1-(4-cyclopentyloxyphenyl)-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | Cc1cc([C@H]2[C@@H](c3ccccn3)NC(=S)N2c2ccc(OC3CCCC3)cc2)c(C)n1C1CCCC1 |
| InChI | InChI=1S/C30H36N4OS/c1-20-19-26(21(2)33(20)22-9-3-4-10-22)29-28(27-13-7-8-18-31-27)32-30(36)34(29)23-14-16-25(17-15-23)35-24-11-5-6-12-24/h7-8,13-19,22,24,28-29H,3-6,9-12H2,1-2H3,(H,32,36)/t28-,29+/m1/s1 |
| InChIKey | ZXIXDASVYXFUEP-WDYNHAJCSA-N |
| XLogP | 7.11 |
| TPSA | 42.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.71 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|