C32H34N4O2S — CID 133244177
1-(4-cyclopentyloxyphenyl)-5-[1-(3-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 133244177) has the molecular formula C32H34N4O2S and a molecular weight of 538.72 g/mol. Its IUPAC name is 1-(4-cyclopentyloxyphenyl)-5-[1-(3-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | 1-(4-cyclopentyloxyphenyl)-5-[1-(3-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 133244177 |
| Molecular Formula | C32H34N4O2S |
| Molecular Weight | 538.72 g/mol |
| Exact Mass | 538.24 |
| IUPAC Name | 1-(4-cyclopentyloxyphenyl)-5-[1-(3-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | COc1cccc(-n2c(C)cc(C3C(c4ccccn4)NC(=S)N3c3ccc(OC4CCCC4)cc3)c2C)c1 |
| InChI | InChI=1S/C32H34N4O2S/c1-21-19-28(22(2)35(21)24-9-8-12-27(20-24)37-3)31-30(29-13-6-7-18-33-29)34-32(39)36(31)23-14-16-26(17-15-23)38-25-10-4-5-11-25/h6-9,12-20,25,30-31H,4-5,10-11H2,1-3H3,(H,34,39) |
| InChIKey | YSEYGLUDCDCOEY-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 51.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.72 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|