C27H26N4OS — CID 133157702
5-[1-(3-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]-1-phenyl-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 133157702) has the molecular formula C27H26N4OS and a molecular weight of 454.60 g/mol. Its IUPAC name is 5-[1-(3-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]-1-phenyl-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | 5-[1-(3-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]-1-phenyl-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 133157702 |
| Molecular Formula | C27H26N4OS |
| Molecular Weight | 454.60 g/mol |
| Exact Mass | 454.18 |
| IUPAC Name | 5-[1-(3-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]-1-phenyl-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | COc1cccc(-n2c(C)cc(C3C(c4ccccn4)NC(=S)N3c3ccccc3)c2C)c1 |
| InChI | InChI=1S/C27H26N4OS/c1-18-16-23(19(2)30(18)21-12-9-13-22(17-21)32-3)26-25(24-14-7-8-15-28-24)29-27(33)31(26)20-10-5-4-6-11-20/h4-17,25-26H,1-3H3,(H,29,33) |
| InChIKey | JLDZCKQBMNVBMU-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 42.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.60 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|