C34H32N4O2S — CID 133183740
5-[1-(3-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]-1-[4-(4-methylphenoxy)phenyl]-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 133183740) has the molecular formula C34H32N4O2S and a molecular weight of 560.72 g/mol. Its IUPAC name is 5-[1-(3-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]-1-[4-(4-methylphenoxy)phenyl]-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | 5-[1-(3-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]-1-[4-(4-methylphenoxy)phenyl]-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 133183740 |
| Molecular Formula | C34H32N4O2S |
| Molecular Weight | 560.72 g/mol |
| Exact Mass | 560.22 |
| IUPAC Name | 5-[1-(3-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]-1-[4-(4-methylphenoxy)phenyl]-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | COc1cccc(-n2c(C)cc(C3C(c4ccccn4)NC(=S)N3c3ccc(Oc4ccc(C)cc4)cc3)c2C)c1 |
| InChI | InChI=1S/C34H32N4O2S/c1-22-11-15-27(16-12-22)40-28-17-13-25(14-18-28)38-33(32(36-34(38)41)31-10-5-6-19-35-31)30-20-23(2)37(24(30)3)26-8-7-9-29(21-26)39-4/h5-21,32-33H,1-4H3,(H,36,41) |
| InChIKey | PHXLSYSFBHDOIP-UHFFFAOYSA-N |
| XLogP | 7.78 |
| TPSA | 51.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.72 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|