C28H27ClN4O2S — CID 100512851
(4R,5S)-1-(3-chloro-4-methoxyphenyl)-5-[1-(3-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 100512851) has the molecular formula C28H27ClN4O2S and a molecular weight of 519.07 g/mol. Its IUPAC name is (4R,5S)-1-(3-chloro-4-methoxyphenyl)-5-[1-(3-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | (4R,5S)-1-(3-chloro-4-methoxyphenyl)-5-[1-(3-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 100512851 |
| Molecular Formula | C28H27ClN4O2S |
| Molecular Weight | 519.07 g/mol |
| Exact Mass | 518.15 |
| IUPAC Name | (4R,5S)-1-(3-chloro-4-methoxyphenyl)-5-[1-(3-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | COc1cccc(-n2c(C)cc([C@H]3[C@H](c4ccccn4)NC(=S)N3c3ccc(OC)c(Cl)c3)c2C)c1 |
| InChI | InChI=1S/C28H27ClN4O2S/c1-17-14-22(18(2)32(17)19-8-7-9-21(15-19)34-3)27-26(24-10-5-6-13-30-24)31-28(36)33(27)20-11-12-25(35-4)23(29)16-20/h5-16,26-27H,1-4H3,(H,31,36)/t26-,27-/m0/s1 |
| InChIKey | RIXMUCCUYVYFPQ-SVBPBHIXSA-N |
| XLogP | 6.34 |
| TPSA | 51.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.07 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|